|
CAS#: 2824-31-9 Product: Potassium 2-Ethylhexoxymethanedithioate No suppilers available for the product. |
| Name | Potassium 2-Ethylhexoxymethanedithioate |
|---|---|
| Synonyms | Potassium O-(2-Ethylhexyl) Dithiocarbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H17KOS2 |
| Molecular Weight | 244.45 |
| CAS Registry Number | 2824-31-9 |
| EINECS | 220-582-1 |
| SMILES | C(OC([S-])=S)C(CCCC)CC.[K+] |
| InChI | 1S/C9H18OS2.K/c1-3-5-6-8(4-2)7-10-9(11)12;/h8H,3-7H2,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | MBPCIOPMOKXKRD-UHFFFAOYSA-M |
| Boiling point | 245.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 102.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 2-Ethylhexoxymethanedithioate |