|
CAS#: 28255-97-2 Product: 11a,12,13,13alpha-Tetrahydro-11,1-Metheno-1H-Cyclohepta[b]Heptalene No suppilers available for the product. |
| Name | 11a,12,13,13alpha-Tetrahydro-11,1-Metheno-1H-Cyclohepta[b]Heptalene |
|---|---|
| Synonyms | 11,1-Metheno-1H-Cyclohepta[B]Heptalene,11A,12,13,13A-Tetrahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 28255-97-2 |
| SMILES | C4C1C2=CC=CC=C1C=C3C(C(=C2)C=CC=C3)C4 |
| InChI | 1S/C18H16/c1-2-6-14-12-16-8-4-3-7-15-11-13(5-1)17(14)9-10-18(15)16/h1-8,11-12,17-18H,9-10H2 |
| InChIKey | XNJNSGJEBSIKOD-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.699°C at 760 mmHg (Cal.) |
| Flash point | 224.787°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11a,12,13,13alpha-Tetrahydro-11,1-Metheno-1H-Cyclohepta[b]Heptalene |