Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4'-O-Acetylacetosyringone |
|---|---|
| Synonyms | (4-Acetyl-2,6-Dimethoxy-Phenyl) Acetate; Acetic Acid (4-Acetyl-2,6-Dimethoxyphenyl) Ester; Acetic Acid (4-Acetyl-2,6-Dimethoxy-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 28294-47-5 |
| EINECS | 248-942-3 |
| SMILES | C1=C(C(C)=O)C=C(C(=C1OC)OC(C)=O)OC |
| InChI | 1S/C12H14O5/c1-7(13)9-5-10(15-3)12(17-8(2)14)11(6-9)16-4/h5-6H,1-4H3 |
| InChIKey | SUFHOFZQYXKUCA-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.003°C at 760 mmHg (Cal.) |
| Flash point | 142.253°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4'-O-Acetylacetosyringone |