|
CAS#: 28305-60-4 Product: 1-[(1S,3aR,7S,7aS)-7-Isopropyl-4-Methyleneoctahydro-1H-Inden-1-Yl]Ethanone No suppilers available for the product. |
| Name | 1-[(1S,3aR,7S,7aS)-7-Isopropyl-4-Methyleneoctahydro-1H-Inden-1-Yl]Ethanone |
|---|---|
| Synonyms | oplopenone; β-oplopenone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 28305-60-4 |
| SMILES | CC(=O)[C@H]1CC[C@H]2C(=C)CC[C@@H](C(C)C)[C@H]12 |
| InChI | 1S/C15H24O/c1-9(2)12-6-5-10(3)13-7-8-14(11(4)16)15(12)13/h9,12-15H,3,5-8H2,1-2,4H3/t12-,13-,14+,15-/m0/s1 |
| InChIKey | YKWVCZPTAAKDIY-XQLPTFJDSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.089°C at 760 mmHg (Cal.) |
| Flash point | 122.861°C (Cal.) |
| Refractive index | 1.484 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1S,3aR,7S,7aS)-7-Isopropyl-4-Methyleneoctahydro-1H-Inden-1-Yl]Ethanone |