|
CAS#: 28341-68-6 Product: 4,4'-Thiobis[6-Chlororesorcinol] No suppilers available for the product. |
| Name | 4,4'-Thiobis[6-Chlororesorcinol] |
|---|---|
| Synonyms | 4-Chloro-6-(5-Chloro-2,4-Dihydroxy-Phenyl)Sulfanyl-Benzene-1,3-Diol; 4-Chloro-6-[(5-Chloro-2,4-Dihydroxyphenyl)Thio]Benzene-1,3-Diol; 4-Chloro-6-[(5-Chloro-2,4-Dihydroxy-Phenyl)Thio]Resorcinol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2O4S |
| Molecular Weight | 319.16 |
| CAS Registry Number | 28341-68-6 |
| SMILES | C1=C(C(=CC(=C1Cl)O)O)SC2=C(O)C=C(C(=C2)Cl)O |
| InChI | 1S/C12H8Cl2O4S/c13-5-1-11(9(17)3-7(5)15)19-12-2-6(14)8(16)4-10(12)18/h1-4,15-18H |
| InChIKey | RIPFOQYATDLGCF-UHFFFAOYSA-N |
| Density | 1.826g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.896°C at 760 mmHg (Cal.) |
| Flash point | 294.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Thiobis[6-Chlororesorcinol] |