|
CAS#: 28395-11-1 Product: 3-(Benzylamino)-4-phenoxy-5-sulfamoylbenzoic acid No suppilers available for the product. |
| Name | 3-(Benzylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
|---|---|
| Synonyms | 4-(Phenoxy)-3-(Phenylmethylamino)-5-Sulfamoyl-Benzoic Acid; 3-(Benzylamino)-4-(Phenoxy)-5-Sulfamoyl-Benzoic Acid; 3-Benzylamino-4-Phenoxy-5-Sulfamoylbenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.43 |
| CAS Registry Number | 28395-11-1 |
| SMILES | C1=C(C(=C(C=C1C(=O)O)NCC2=CC=CC=C2)OC3=CC=CC=C3)[S](=O)(=O)N |
| InChI | 1S/C20H18N2O5S/c21-28(25,26)18-12-15(20(23)24)11-17(22-13-14-7-3-1-4-8-14)19(18)27-16-9-5-2-6-10-16/h1-12,22H,13H2,(H,23,24)(H2,21,25,26) |
| InChIKey | UCNWQTMKAPAUHU-UHFFFAOYSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.912°C at 760 mmHg (Cal.) |
| Flash point | 328.711°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Benzylamino)-4-phenoxy-5-sulfamoylbenzoic acid |