Online Database of Chemicals from Around the World
| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 624-4882 | |||
 |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink massive supplier since 2016 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N-[(Benzyloxy)Carbonyl]-L-Phenylalanyl-L-Histidyl-L-Leucine |
|---|---|
| Synonyms | Z-PHE-HIS-LEU-OH |
| Molecular Structure | ![CAS#: 28458-19-7, N-[(Benzyloxy)Carbonyl]-L-Phenylalanyl-L-Histidyl-L-Leucine](/moreStructures/28458-19-7.gif) |
| Molecular Formula | C29H35N5O6 |
| Molecular Weight | 549.62 |
| CAS Registry Number | 28458-19-7 |
| SMILES | O=C(O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OCc1ccccc1)Cc2ccccc2)Cc3cncn3)CC(C)C |
| InChI | 1S/C29H35N5O6/c1-19(2)13-25(28(37)38)33-27(36)24(15-22-16-30-18-31-22)32-26(35)23(14-20-9-5-3-6-10-20)34-29(39)40-17-21-11-7-4-8-12-21/h3-12,16,18-19,23-25H,13-15,17H2,1-2H3,(H,30,31)(H,32,35)(H,33,36)(H,34,39)(H,37,38)/t23-,24-,25-/m0/s1 |
| InChIKey | BOMYCHBQXOKSLT-SDHOMARFSA-N |
| Protein Sequence | Z-Phe-His-Leu-OH |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 936.99°C at 760 mmHg (Cal.) |
| Flash point | 520.473°C (Cal.) |
| Refractive index | 1.593 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(Benzyloxy)Carbonyl]-L-Phenylalanyl-L-Histidyl-L-Leucine |