|
CAS#: 28462-85-3 Product: Endo-1,2,3,3-Tetramethylbicyclo[2.2.1]Heptan-2-Ol No suppilers available for the product. |
| Name | Endo-1,2,3,3-Tetramethylbicyclo[2.2.1]Heptan-2-Ol |
|---|---|
| Synonyms | (1R,2R,4R)-1,2,3,3-Tetramethylnorbornan-2-Ol; (1R,2R,4R)-1,2,3,3-Tetramethyl-2-Norbornanol; 1,2,3,3-Tetramethylbicyclo(2.2.1)Heptan-2-Ol,Endo- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 |
| CAS Registry Number | 28462-85-3 |
| EINECS | 249-036-0 |
| SMILES | [C@@]1([C@]2(C[C@H](C1(C)C)CC2)C)(O)C |
| InChI | 1S/C11H20O/c1-9(2)8-5-6-10(3,7-8)11(9,4)12/h8,12H,5-7H2,1-4H3/t8-,10-,11+/m1/s1 |
| InChIKey | AJVKAPQCJKEUSG-IEBDPFPHSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 208.688°C at 760 mmHg (Cal.) |
| Flash point | 83.496°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Endo-1,2,3,3-Tetramethylbicyclo[2.2.1]Heptan-2-Ol |