|
CAS#: 28519-31-5 Product: Butyl p-toluenethiosulfonate No suppilers available for the product. |
| Name | Butyl p-toluenethiosulfonate |
|---|---|
| Synonyms | 1-Methyl-4-Sec-Butoxysulfonothioyl-Benzene; 1-Methyl-4-Sec-Butoxysulfonothioylbenzene; 1-Butan-2-Yloxysulfonothioyl-4-Methyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.37 |
| CAS Registry Number | 28519-31-5 |
| SMILES | C1=CC(=CC=C1[S](=O)(OC(CC)C)=S)C |
| InChI | 1S/C11H16O2S2/c1-4-10(3)13-15(12,14)11-7-5-9(2)6-8-11/h5-8,10H,4H2,1-3H3 |
| InChIKey | SWSLFIWCSJJESK-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.774°C at 760 mmHg (Cal.) |
| Flash point | 151.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl p-toluenethiosulfonate |