|
CAS#: 28520-18-5 Product: 2-(2,3,4,5,6-Pentafluorophenyl)Acetaldehyde No suppilers available for the product. |
| Name | 2-(2,3,4,5,6-Pentafluorophenyl)Acetaldehyde |
|---|---|
| Synonyms | 2-(perfluorophenyl)acetaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3F5O |
| Molecular Weight | 210.10 |
| CAS Registry Number | 28520-18-5 |
| SMILES | Fc1c(CC=O)c(F)c(F)c(F)c1F |
| InChI | 1S/C8H3F5O/c9-4-3(1-2-14)5(10)7(12)8(13)6(4)11/h2H,1H2 |
| InChIKey | GYKZSGBPECIBTN-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 180.213°C at 760 mmHg (Cal.) |
| Flash point | 65.72°C (Cal.) |
| Refractive index | 1.425 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,3,4,5,6-Pentafluorophenyl)Acetaldehyde |