|
CAS#: 28567-53-5 Product: (2R,3S,4R,5R)-N-(2-Ethylhexyl)-2,3,4,5,6-Pentahydroxyhexanamide No suppilers available for the product. |
| Name | (2R,3S,4R,5R)-N-(2-Ethylhexyl)-2,3,4,5,6-Pentahydroxyhexanamide |
|---|---|
| Synonyms | N-(2-ethylhexyl)-D-gluconamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.38 |
| CAS Registry Number | 28567-53-5 |
| EINECS | 249-084-2 |
| SMILES | O[C@H]([C@@H](O)C(=O)NCC(CC)CCCC)[C@H](O)[C@H](O)CO |
| InChI | 1S/C14H29NO6/c1-3-5-6-9(4-2)7-15-14(21)13(20)12(19)11(18)10(17)8-16/h9-13,16-20H,3-8H2,1-2H3,(H,15,21)/t9?,10-,11-,12+,13-/m1/s1 |
| InChIKey | GUBOZUXRNZWHIW-FOMPKITHSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 624.438°C at 760 mmHg (Cal.) |
| Flash point | 331.448°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S,4R,5R)-N-(2-Ethylhexyl)-2,3,4,5,6-Pentahydroxyhexanamide |