|
CAS#: 28571-00-8 Product: 2-(N-Acetyl-N-Ethylaminomethyl)-1H-Pyrrole No suppilers available for the product. |
| Name | 2-(N-Acetyl-N-Ethylaminomethyl)-1H-Pyrrole |
|---|---|
| Synonyms | N-Ethyl-N-(1H-Pyrrol-2-Ylmethyl)Ethanamide; Pyrrole, 2-((N-Acetyl-N-Ethylamino)Methyl)-; 2-((N-Acetyl-N-Ethylamino)Methyl)Pyrrole |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 |
| CAS Registry Number | 28571-00-8 |
| SMILES | C1=CC=C([NH]1)CN(C(=O)C)CC |
| InChI | 1S/C9H14N2O/c1-3-11(8(2)12)7-9-5-4-6-10-9/h4-6,10H,3,7H2,1-2H3 |
| InChIKey | HNXYMNAOMXCHIY-UHFFFAOYSA-N |
| Density | 1.076g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.169°C at 760 mmHg (Cal.) |
| Flash point | 149.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(N-Acetyl-N-Ethylaminomethyl)-1H-Pyrrole |