|
CAS#: 28624-23-9 Product: 6-Isopropyl-4,8A-Dimethyl-1,2,3,7,8,8A-Hexahydronaphthalene No suppilers available for the product. |
| Name | 6-Isopropyl-4,8A-Dimethyl-1,2,3,7,8,8A-Hexahydronaphthalene |
|---|---|
| Synonyms | (10ξ)-eudesma-4,6-diene; (10ξ)-eud |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 28624-23-9 |
| SMILES | C2(=C1\C=C(/CCC1(CCC2)C)C(C)C)\C |
| InChI | 1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h10-11H,5-9H2,1-4H3 |
| InChIKey | VEGYMPQCXPVQJY-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.881°C at 760 mmHg (Cal.) |
| Flash point | 112.053°C (Cal.) |
| Refractive index | 1.501 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Isopropyl-4,8A-Dimethyl-1,2,3,7,8,8A-Hexahydronaphthalene |