|
CAS#: 2864-61-1 Product: Ethyl-Phosphoramidic acid ethyl 2,4,5-trichlorophenyl ester No suppilers available for the product. |
| Name | Ethyl-Phosphoramidic acid ethyl 2,4,5-trichlorophenyl ester |
|---|---|
| Synonyms | [Ethoxy-(2,4,5-Trichlorophenoxy)Phosphoryl]-Ethyl-Amine; Brn 1888816; Dowco 210 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13Cl3NO3P |
| Molecular Weight | 332.55 |
| CAS Registry Number | 2864-61-1 |
| SMILES | C1=C(O[P](OCC)(=O)NCC)C(=CC(=C1Cl)Cl)Cl |
| InChI | 1S/C10H13Cl3NO3P/c1-3-14-18(15,16-4-2)17-10-6-8(12)7(11)5-9(10)13/h5-6H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | PMWRWPFHACHCIJ-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.257°C at 760 mmHg (Cal.) |
| Flash point | 183.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl-Phosphoramidic acid ethyl 2,4,5-trichlorophenyl ester |