|
CAS#: 28669-41-2 Product: 3-Phenyl-5-Propyl-1,3,4-Oxadiazol-2(3H)-One No suppilers available for the product. |
| Name | 3-Phenyl-5-Propyl-1,3,4-Oxadiazol-2(3H)-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 28669-41-2 |
| SMILES | O=C2OC(=N/N2c1ccccc1)\CCC |
| InChI | 1S/C11H12N2O2/c1-2-6-10-12-13(11(14)15-10)9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | ACTYXXRNJQYNLB-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.643°C at 760 mmHg (Cal.) |
| Flash point | 119.9°C (Cal.) |
| Refractive index | 1.583 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Phenyl-5-Propyl-1,3,4-Oxadiazol-2(3H)-One |