|
CAS#: 28680-44-6 Product: Hexachloronorbornadiene No suppilers available for the product. |
| Name | Hexachloronorbornadiene |
|---|---|
| Synonyms | Bicyclo(2.2.1)Hepta-2,5-Diene, Hexachloro-; Hex-Bch; Hexachlorobicycloheptadiene |
| Molecular Structure | ![]() |
| Molecular Formula | C7H2Cl6 |
| Molecular Weight | 298.81 |
| CAS Registry Number | 28680-44-6 |
| SMILES | ClC12C(=C(C(C(=C1Cl)Cl)(C2)Cl)Cl)Cl |
| InChI | 1S/C7H2Cl6/c8-2-3(9)7(13)1-6(2,12)4(10)5(7)11/h1H2 |
| InChIKey | ZKRSTHSWOFIHMZ-UHFFFAOYSA-N |
| Density | 1.829g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.645°C at 760 mmHg (Cal.) |
| Flash point | 142.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexachloronorbornadiene |