|
CAS#: 28692-27-5 Product: 3-Amino-1-Imino-5-Methoxy-1H-Isoindole No suppilers available for the product. |
| Name | 3-Amino-1-Imino-5-Methoxy-1H-Isoindole |
|---|---|
| Synonyms | 3-Imino-5-Methoxy-Isoindol-1-Amine; 3-Imino-5-Methoxy-1-Isoindolamine; (3-Imino-5-Methoxy-Isoindol-1-Yl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 |
| CAS Registry Number | 28692-27-5 |
| EINECS | 249-158-4 |
| SMILES | C1=C(OC)C=CC2=C1C(N=C2N)=N |
| InChI | 1S/C9H9N3O/c1-13-5-2-3-6-7(4-5)9(11)12-8(6)10/h2-4H,1H3,(H3,10,11,12) |
| InChIKey | ULNBACHCVNVEHG-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.106°C at 760 mmHg (Cal.) |
| Flash point | 165.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-1-Imino-5-Methoxy-1H-Isoindole |