|
CAS#: 286958-01-8 Product: N-Benzyl-4-(2,6-Dichloro-4-Nitro-Phenyl)Azo-N-Methyl-Aniline No suppilers available for the product. |
| Name | N-Benzyl-4-(2,6-Dichloro-4-Nitro-Phenyl)Azo-N-Methyl-Aniline |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H16Cl2N4O2 |
| Molecular Weight | 415.27 |
| CAS Registry Number | 286958-01-8 |
| SMILES | CN(Cc1ccccc1)c2ccc(cc2)N=Nc3c(cc(cc3Cl)[N+](=O)[O-])Cl |
| InChI | 1S/C20H16Cl2N4O2/c1-25(13-14-5-3-2-4-6-14)16-9-7-15(8-10-16)23-24-20-18(21)11-17(26(27)28)12-19(20)22/h2-12H,13H2,1H3 |
| InChIKey | RTSFYDHMSFFZTI-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.886°C at 760 mmHg (Cal.) |
| Flash point | 309.947°C (Cal.) |
| Refractive index | 1.635 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzyl-4-(2,6-Dichloro-4-Nitro-Phenyl)Azo-N-Methyl-Aniline |