|
CAS#: 2872-90-4 Product: Androst-4-En-3-One No suppilers available for the product. |
| Name | Androst-4-En-3-One |
|---|---|
| Synonyms | .Delta.4-Androsten-3-One; 17-Deoxytestosterone; 4-Androsten-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 |
| CAS Registry Number | 2872-90-4 |
| SMILES | [C@@H]23[C@H]([C@H]1[C@](CCC1)(C)CC2)CCC4=CC(=O)CC[C@]34C |
| InChI | 1S/C19H28O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h12,15-17H,3-11H2,1-2H3/t15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | MSEZLHAVPJYYIQ-VMXHOPILSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.647°C at 760 mmHg (Cal.) |
| Flash point | 180.587°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Androst-4-En-3-One |