|
CAS#: 28740-67-2 Product: 4-Acetyl-5-Methyl-2-Phenyl-2,4-Dihydro-3H-1,2,4-Triazol-3-One No suppilers available for the product. |
| Name | 4-Acetyl-5-Methyl-2-Phenyl-2,4-Dihydro-3H-1,2,4-Triazol-3-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.22 |
| CAS Registry Number | 28740-67-2 |
| SMILES | CC(=O)N2C(\C)=N/N(c1ccccc1)C2=O |
| InChI | 1S/C11H11N3O2/c1-8-12-14(10-6-4-3-5-7-10)11(16)13(8)9(2)15/h3-7H,1-2H3 |
| InChIKey | STRLEIRQRNXIPA-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.319°C at 760 mmHg (Cal.) |
| Flash point | 142.081°C (Cal.) |
| Refractive index | 1.621 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetyl-5-Methyl-2-Phenyl-2,4-Dihydro-3H-1,2,4-Triazol-3-One |