|
CAS#: 28740-99-0 Product: 1,2,3,4,6,7-Hexahydro-9-Chloro-2 -Phenyl-Pyrrolo(1,2,3-ef)(1,5)Benzodiazepine Monohydrochloride No suppilers available for the product. |
| Name | 1,2,3,4,6,7-Hexahydro-9-Chloro-2 -Phenyl-Pyrrolo(1,2,3-ef)(1,5)Benzodiazepine Monohydrochloride |
|---|---|
| Synonyms | 1,2,3,4,6,7-Hexahydro-9-Chloro-2-Phenylpyrrolo(1,2,3-Ef)(1,5)Benzodiazepine Hydrochloride; 9-Chloro-1,2,4,5,6,7-Hexahydro-6-Phenylpyrrolo(1,2,3-Ef)(1,5)Benzodiazepine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 |
| CAS Registry Number | 28740-99-0 |
| SMILES | [H+].C3=C1NC(CCN2C1=C(CC2)C=C3Cl)C4=CC=CC=C4.[Cl-] |
| InChI | 1S/C17H17ClN2.ClH/c18-14-10-13-6-8-20-9-7-15(12-4-2-1-3-5-12)19-16(11-14)17(13)20;/h1-5,10-11,15,19H,6-9H2;1H |
| InChIKey | DAKVTZUQZJNMSD-UHFFFAOYSA-N |
| Boiling point | 471.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,6,7-Hexahydro-9-Chloro-2 -Phenyl-Pyrrolo(1,2,3-ef)(1,5)Benzodiazepine Monohydrochloride |