|
CAS#: 28777-70-0 Product: Tris(Tert-Butylphenyl) Phosphate No suppilers available for the product. |
| Name | Tris(Tert-Butylphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Tris(2-Tert-Butylphenyl) Ester; Mil-H-19457C |
| Molecular Structure | ![]() |
| Molecular Formula | C30H39O4P |
| Molecular Weight | 494.61 |
| CAS Registry Number | 28777-70-0 |
| EINECS | 249-209-0 |
| SMILES | C1=C(C(=CC=C1)O[P](OC2=CC=CC=C2C(C)(C)C)(=O)OC3=CC=CC=C3C(C)(C)C)C(C)(C)C |
| InChI | 1S/C30H39O4P/c1-28(2,3)22-16-10-13-19-25(22)32-35(31,33-26-20-14-11-17-23(26)29(4,5)6)34-27-21-15-12-18-24(27)30(7,8)9/h10-21H,1-9H3 |
| InChIKey | SPUXJWDKFVXXBI-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.08°C at 760 mmHg (Cal.) |
| Flash point | 285.578°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(Tert-Butylphenyl) Phosphate |