|
CAS#: 28783-31-5 Product: 3-[(E)-2-Nitrovinyl]Thiophene No suppilers available for the product. |
| Name | 3-[(E)-2-Nitrovinyl]Thiophene |
|---|---|
| Synonyms | (E)-3-(2-nitrovinyl)thiophene |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5NO2S |
| Molecular Weight | 155.17 |
| CAS Registry Number | 28783-31-5 |
| SMILES | C1=CSC=C1/C=C/[N+](=O)[O-] |
| InChI | 1S/C6H5NO2S/c8-7(9)3-1-6-2-4-10-5-6/h1-5H/b3-1+ |
| InChIKey | BKLSHYMRBHFIAN-HNQUOIGGSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.7±15.0°C at 760 mmHg (Cal.) |
| Flash point | 116.9±20.4°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(E)-2-Nitrovinyl]Thiophene |