Online Database of Chemicals from Around the World
|
CAS#: 28805-35-8 Product: 1-(1,2,3,5,6,7-Hexahydrotetramethyl-S-Indacenyl)Ethanone No suppilers available for the product. |
| Name | 1-(1,2,3,5,6,7-Hexahydrotetramethyl-S-Indacenyl)Ethanone |
|---|---|
| Synonyms | 1-(1,2,3,5,6,7-Hexahydrotetramethyl-S-Indacenyl)Ethanone |
| Molecular Structure |  |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 |
| CAS Registry Number | 28805-35-8 |
| EINECS | 249-243-6 |
| SMILES | C1=C3C(=CC2=C1C(C(C2C)(C)C)(C(=O)C)C)CCC3 |
| InChI | 1S/C18H24O/c1-11-15-9-13-7-6-8-14(13)10-16(15)18(5,12(2)19)17(11,3)4/h9-11H,6-8H2,1-5H3 |
| InChIKey | BKTMTSLLVROZJR-UHFFFAOYSA-N |
| Density | 1.003g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.337°C at 760 mmHg (Cal.) |
| Flash point | 147.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,2,3,5,6,7-Hexahydrotetramethyl-S-Indacenyl)Ethanone |