Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-Chloromuconic Acid |
|---|---|
| Synonyms | (2Z,4E)-2-Chlorohexa-2,4-Dienedioic Acid; 2,4-Hexadienedioic Acid, 2-Chloro-; 2,4-Hexadienedioic Acid, Chloro- |
| Molecular Structure |  |
| Molecular Formula | C6H5ClO4 |
| Molecular Weight | 176.56 |
| CAS Registry Number | 28823-37-2 |
| SMILES | O=C(\C(=C\C=C\C(=O)O)Cl)O |
| InChI | 1S/C6H5ClO4/c7-4(6(10)11)2-1-3-5(8)9/h1-3H,(H,8,9)(H,10,11)/b3-1+,4-2- |
| InChIKey | OZNNVVBQWHRHHH-TZFCGSKZSA-N |
| Density | 1.532g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.294°C at 760 mmHg (Cal.) |
| Flash point | 152.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloromuconic Acid |