|
CAS#: 28837-82-3 Product: N,N-Diethyl-3-Formyl-5-Methoxy-1H-Indole-2-Carboxamide No suppilers available for the product. |
| Name | N,N-Diethyl-3-Formyl-5-Methoxy-1H-Indole-2-Carboxamide |
|---|---|
| Synonyms | N,N-Diethyl-3-Methanoyl-5-Methoxy-1H-Indole-2-Carboxamide; Brn 0412323; Indole-2-Carboxamide, N,N-Diethyl-3-Formyl-5-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 |
| CAS Registry Number | 28837-82-3 |
| SMILES | C1=C(C=CC2=C1C(=C([NH]2)C(=O)N(CC)CC)C=O)OC |
| InChI | 1S/C15H18N2O3/c1-4-17(5-2)15(19)14-12(9-18)11-8-10(20-3)6-7-13(11)16-14/h6-9,16H,4-5H2,1-3H3 |
| InChIKey | QFAZJCFBYQXBBI-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.963°C at 760 mmHg (Cal.) |
| Flash point | 266.45°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-3-Formyl-5-Methoxy-1H-Indole-2-Carboxamide |