|
CAS#: 288399-52-0 Product: 3-Bromo-6-(2-Methyl-2-Propanyl)-4H-Chromen-4-One No suppilers available for the product. |
| Name | 3-Bromo-6-(2-Methyl-2-Propanyl)-4H-Chromen-4-One |
|---|---|
| Synonyms | 3-Brom-6-(2-methyl-2-propanyl)-4H-chromen-4-on; 3-Bromo-6-(2-methyl-2-propanyl)-4H-chromen-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 |
| CAS Registry Number | 288399-52-0 |
| SMILES | CC(C)(C)c1ccc2c(c1)c(=O)c(co2)Br |
| InChI | 1S/C13H13BrO2/c1-13(2,3)8-4-5-11-9(6-8)12(15)10(14)7-16-11/h4-7H,1-3H3 |
| InChIKey | BMGAFYQPEZYXJD-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 149.3±27.9°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-6-(2-Methyl-2-Propanyl)-4H-Chromen-4-One |