|
CAS#: 28883-95-6 Product: 3-(4-Methylphenyl)-2H-azirene-2-carboxamide No suppilers available for the product. |
| Name | 3-(4-Methylphenyl)-2H-azirene-2-carboxamide |
|---|---|
| Synonyms | 2H-Azirine-2-carboxamide, 3-p-tolyl-; 3-(4-Methylphenyl)-2H-azirene-2-carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 |
| CAS Registry Number | 28883-95-6 |
| SMILES | O=C(N)C2/N=C2/c1ccc(cc1)C |
| InChI | 1S/C10H10N2O/c1-6-2-4-7(5-3-6)8-9(12-8)10(11)13/h2-5,9H,1H3,(H2,11,13) |
| InChIKey | NCTSBSGNXVYAPU-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.135°C at 760 mmHg (Cal.) |
| Flash point | 189.142°C (Cal.) |
| Refractive index | 1.653 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Methylphenyl)-2H-azirene-2-carboxamide |