Online Database of Chemicals from Around the World
| Name | Bis(2,3-Dibromopropyl) Chlorophosphate |
|---|---|
| Synonyms | 1,2-Dibromo-3-(Chloro-(2,3-Dibromopropoxy)Phosphoryl)Oxy-Propane; Bis(2,3-Dibromopropyl) Chlorophosphate |
| Molecular Structure |  |
| Molecular Formula | C6H10Br4ClO3P |
| Molecular Weight | 516.19 |
| CAS Registry Number | 28888-24-6 |
| EINECS | 249-287-6 |
| SMILES | C(O[P](OCC(Br)CBr)(=O)Cl)C(Br)CBr |
| InChI | 1S/C6H10Br4ClO3P/c7-1-5(9)3-13-15(11,12)14-4-6(10)2-8/h5-6H,1-4H2 |
| InChIKey | DVASKQOEUNSJHT-UHFFFAOYSA-N |
| Density | 2.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.566°C at 760 mmHg (Cal.) |
| Flash point | 230.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,3-Dibromopropyl) Chlorophosphate |
