|
CAS#: 2890-88-2 Product: Trichloro(Triethylamine)Boron No suppilers available for the product. |
| Name | Trichloro(Triethylamine)Boron |
|---|---|
| Synonyms | Boron; 1,1,2-Trichloro-N,N-Diethyl-Ethanamine; Boron; Diethyl-(1,1,2-Trichloroethyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12BCl3N |
| Molecular Weight | 215.34 |
| CAS Registry Number | 2890-88-2 |
| EINECS | 220-758-8 |
| SMILES | [B].C(Cl)C(Cl)(Cl)N(CC)CC |
| InChI | 1S/C6H12Cl3N.B/c1-3-10(4-2)6(8,9)5-7;/h3-5H2,1-2H3; |
| InChIKey | NIZHAXJMZRHJNG-UHFFFAOYSA-N |
| Boiling point | 160.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 50.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloro(Triethylamine)Boron |