|
CAS#: 289630-80-4 Product: 1-(5,7-Dimethyl-1,8-Naphthyridin-2-Yl)-1-(3-Methylphenyl)Urea No suppilers available for the product. |
| Name | 1-(5,7-Dimethyl-1,8-Naphthyridin-2-Yl)-1-(3-Methylphenyl)Urea |
|---|---|
| Synonyms | UREA,N-(5 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.36 |
| CAS Registry Number | 289630-80-4 |
| SMILES | Cc1cccc(c1)N(c2ccc3c(cc(nc3n2)C)C)C(=O)N |
| InChI | 1S/C18H18N4O/c1-11-5-4-6-14(9-11)22(18(19)23)16-8-7-15-12(2)10-13(3)20-17(15)21-16/h4-10H,1-3H3,(H2,19,23) |
| InChIKey | AFZWEIOGBKLFPX-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.382°C at 760 mmHg (Cal.) |
| Flash point | 265.494°C (Cal.) |
| Refractive index | 1.681 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(5,7-Dimethyl-1,8-Naphthyridin-2-Yl)-1-(3-Methylphenyl)Urea |