|
CAS#: 28971-58-6 Product: Acrocinonide No suppilers available for the product. |
| Name | Acrocinonide |
|---|---|
| Synonyms | 9-Fluoro-11Beta,16Alpha,17,21-Tetrahydroxypregna-1,4-Diene-3,20-Dione Cyclic 16,17-Acetal With Acrolein; Acrocinonid; Acrocinonida |
| Molecular Structure | ![]() |
| Molecular Formula | C24H29FO6 |
| Molecular Weight | 432.49 |
| CAS Registry Number | 28971-58-6 |
| SMILES | [C@]12(OC(O[C@@H]1CC3C2(CC(O)C4(F)C3CCC5=CC(=O)C=CC45C)C)C=C)C(=O)CO |
| InChI | 1S/C24H29FO6/c1-4-20-30-19-10-16-15-6-5-13-9-14(27)7-8-21(13,2)23(15,25)17(28)11-22(16,3)24(19,31-20)18(29)12-26/h4,7-9,15-17,19-20,26,28H,1,5-6,10-12H2,2-3H3/t15?,16?,17?,19-,20?,21?,22?,23?,24-/m1/s1 |
| InChIKey | JGSKXHVNDZFORI-BREAVPFCSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.351°C at 760 mmHg (Cal.) |
| Flash point | 304.785°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acrocinonide |