|
CAS#: 2899-02-7 Product: 1,3-Dichloro-1,3-Bis(2,4,6-Trichlorophenyl)Urea No suppilers available for the product. |
| Name | 1,3-Dichloro-1,3-Bis(2,4,6-Trichlorophenyl)Urea |
|---|---|
| Synonyms | Carbanilide, N,N',2,2',4,4',6,6'-Octachloro- (8Ci); Nsc 56765; Cc 2 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H4Cl8N2O |
| Molecular Weight | 487.81 |
| CAS Registry Number | 2899-02-7 |
| SMILES | C1=C(C(=C(C=C1Cl)Cl)N(C(=O)N(C2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C13H4Cl8N2O/c14-5-1-7(16)11(8(17)2-5)22(20)13(24)23(21)12-9(18)3-6(15)4-10(12)19/h1-4H |
| InChIKey | PQPYGYHIBMHXPC-UHFFFAOYSA-N |
| Density | 1.818g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.991°C at 760 mmHg (Cal.) |
| Flash point | 277.353°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-1,3-Bis(2,4,6-Trichlorophenyl)Urea |