|
CAS#: 29007-11-2 Product: 7-Nitro-8-Quinolyl 4-Chloro-2-Nitrobenzoate No suppilers available for the product. |
| Name | 7-Nitro-8-Quinolyl 4-Chloro-2-Nitrobenzoate |
|---|---|
| Synonyms | (7-Nitro-8-Quinolyl) 4-Chloro-2-Nitro-Benzoate; 4-Chloro-2-Nitrobenzoic Acid (7-Nitro-8-Quinolyl) Ester; 4-Chloro-2-Nitro-Benzoic Acid (7-Nitro-8-Quinolyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H8ClN3O6 |
| Molecular Weight | 373.71 |
| CAS Registry Number | 29007-11-2 |
| SMILES | C2=CC1=CC=CN=C1C(=C2[N+]([O-])=O)OC(=O)C3=CC=C(Cl)C=C3[N+]([O-])=O |
| InChI | 1S/C16H8ClN3O6/c17-10-4-5-11(13(8-10)20(24)25)16(21)26-15-12(19(22)23)6-3-9-2-1-7-18-14(9)15/h1-8H |
| InChIKey | RNLSOOSYGDYNCW-UHFFFAOYSA-N |
| Density | 1.585g/cm3 (Cal.) |
|---|---|
| Boiling point | 644.938°C at 760 mmHg (Cal.) |
| Flash point | 343.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Nitro-8-Quinolyl 4-Chloro-2-Nitrobenzoate |