|
CAS#: 29065-03-0 Product: beta,beta-Carotene-4,4'-Diol No suppilers available for the product. |
| Name | beta,beta-Carotene-4,4'-Diol |
|---|---|
| Synonyms | isozeaxanthin |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56O2 |
| Molecular Weight | 568.87 |
| CAS Registry Number | 29065-03-0 |
| SMILES | OC2C(=C(\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C1=C(\C(O)CCC1(C)C)C)C)C)C)C)C(C)(C)CC2)\C |
| InChI | 1S/C40H56O2/c1-29(17-13-19-31(3)21-23-35-33(5)37(41)25-27-39(35,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-36-34(6)38(42)26-28-40(36,9)10/h11-24,37-38,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+ |
| InChIKey | GYZWNQLEQAGWGD-DKLMTRRASA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 713.735°C at 760 mmHg (Cal.) |
| Flash point | 274.461°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta,beta-Carotene-4,4'-Diol |