|
CAS#: 29085-98-1 Product: (3alpha,5alpha)-11,17-Dioxoandrostan-3-yl beta-D-glucopyranosiduronic acid No suppilers available for the product. |
| Name | (3alpha,5alpha)-11,17-Dioxoandrostan-3-yl beta-D-glucopyranosiduronic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C25H36O9 |
| Molecular Weight | 480.55 |
| CAS Registry Number | 29085-98-1 |
| SMILES | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CCC4=O)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C(=O)O)O)O)O |
| InChI | 1S/C25H36O9/c1-24-8-7-12(33-23-20(30)18(28)19(29)21(34-23)22(31)32)9-11(24)3-4-13-14-5-6-16(27)25(14,2)10-15(26)17(13)24/h11-14,17-21,23,28-30H,3-10H2,1-2H3,(H,31,32)/t11-,12+,13-,14-,17+,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | QTXWOOLAHRQMGZ-QASSVKNGSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 694.471°C at 760 mmHg (Cal.) |
| Flash point | 233.707°C (Cal.) |
| Refractive index | 1.599 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3alpha,5alpha)-11,17-Dioxoandrostan-3-yl beta-D-glucopyranosiduronic acid |