|
CAS#: 29096-65-9 Product: 2-[2-(2,6-Dichlorophenyl)Ethyl]Hydrazinecarboximidamide No suppilers available for the product. |
| Name | 2-[2-(2,6-Dichlorophenyl)Ethyl]Hydrazinecarboximidamide |
|---|---|
| Synonyms | (2,6-Dichlorophenethylamino)Guanidine; Brn 0750009; Guanidine, (2,6-Dichlorophenethylamino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12Cl2N4 |
| Molecular Weight | 247.13 |
| CAS Registry Number | 29096-65-9 |
| SMILES | C1=CC=C(Cl)C(=C1Cl)CCNN=C(N)N |
| InChI | 1S/C9H12Cl2N4/c10-7-2-1-3-8(11)6(7)4-5-14-15-9(12)13/h1-3,14H,4-5H2,(H4,12,13,15) |
| InChIKey | AVJNXOJPLQEEAJ-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.598°C at 760 mmHg (Cal.) |
| Flash point | 202.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(2,6-Dichlorophenyl)Ethyl]Hydrazinecarboximidamide |