|
CAS#: 29110-22-3 Product: 2,2-Dichloropropionic acid, Magnesium salt No suppilers available for the product. |
| Name | 2,2-Dichloropropionic acid, Magnesium salt |
|---|---|
| Synonyms | Magnesium 2,2-Dichloropropionate; 2,2-Dichloropropionic Acid, Magnesium Salt; Dalapon Magnesium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6Cl4MgO4 |
| Molecular Weight | 308.23 |
| CAS Registry Number | 29110-22-3 |
| SMILES | CC(Cl)(Cl)C([O-])=O.CC(Cl)(Cl)C([O-])=O.[Mg++] |
| InChI | 1S/2C3H4Cl2O2.Mg/c2*1-3(4,5)2(6)7;/h2*1H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | QPPXJFBMSFYKMM-UHFFFAOYSA-L |
| Boiling point | 187.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 76.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloropropionic acid, Magnesium salt |