|
CAS#: 29126-51-0 Product: Pentanedioic Acid, Dilithium Salt No suppilers available for the product. |
| Name | Pentanedioic Acid, Dilithium Salt |
|---|---|
| Synonyms | Dilithium Glutarate; Pentanedioic Acid, Dilithium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C5H6Li2O4 |
| Molecular Weight | 143.98 |
| CAS Registry Number | 29126-51-0 |
| SMILES | C(C([O-])=O)CCC([O-])=O.[Li+].[Li+] |
| InChI | 1S/C5H8O4.2Li/c6-4(7)2-1-3-5(8)9;;/h1-3H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
| InChIKey | PLYZFCVUMQOYCR-UHFFFAOYSA-L |
| Boiling point | 302.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentanedioic Acid, Dilithium Salt |