|
CAS#: 29138-41-8 Product: 3,3-Dimethyl-1-Phenyl-1-Phthalanpropylamine Oxalate No suppilers available for the product. |
| Name | 3,3-Dimethyl-1-Phenyl-1-Phthalanpropylamine Oxalate |
|---|---|
| Synonyms | 3-(3,3-Dimethyl-1-Phenyl-Isobenzofuran-1-Yl)Propan-1-Amine; Oxalic Acid; 3-(3,3-Dimethyl-1-Phenyl-1-Isobenzofuranyl)Propan-1-Amine; Oxalic Acid; 3-(3,3-Dimethyl-1-Phenyl-Isobenzofuran-1-Yl)Propylamine; Oxalic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 |
| CAS Registry Number | 29138-41-8 |
| SMILES | C2=C1C(OC(C1=CC=C2)(C)C)(C3=CC=CC=C3)CCCN.O=C(O)C(=O)O |
| InChI | 1S/C19H23NO.C2H2O4/c1-18(2)16-11-6-7-12-17(16)19(21-18,13-8-14-20)15-9-4-3-5-10-15;3-1(4)2(5)6/h3-7,9-12H,8,13-14,20H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DZLQVEDZCDDAKY-UHFFFAOYSA-N |
| Boiling point | 403.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 190°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethyl-1-Phenyl-1-Phthalanpropylamine Oxalate |