|
CAS#: 29190-28-1 Product: 2,4-Bis(Xylylazo)Resorcinol No suppilers available for the product. |
| Name | 2,4-Bis(Xylylazo)Resorcinol |
|---|---|
| Synonyms | (2Z,6E)-2,6-Bis[(2,4-Dimethylphenyl)Hydrazono]Cyclohex-4-Ene-1,3-Dione; (2Z,6E)-2,6-Bis[(2,4-Dimethylphenyl)Hydrazono]Cyclohex-4-Ene-1,3-Quinone; 1,3-Benzenediol, 2,4-Bis((Dimethylphenyl)Azo)- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 |
| CAS Registry Number | 29190-28-1 |
| EINECS | 249-495-7 |
| SMILES | C1=C(C=CC(=C1C)N\N=C3/C(=O)/C(=N/NC2=C(C=C(C=C2)C)C)C=CC3=O)C |
| InChI | 1S/C22H22N4O2/c1-13-5-7-17(15(3)11-13)23-25-19-9-10-20(27)21(22(19)28)26-24-18-8-6-14(2)12-16(18)4/h5-12,23-24H,1-4H3/b25-19+,26-21- |
| InChIKey | JTHUBMQPODORFF-MHVONFLCSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.254°C at 760 mmHg (Cal.) |
| Flash point | 272.069°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(Xylylazo)Resorcinol |