|
CAS#: 29253-36-9 Product: Isopropylnaphthalene No suppilers available for the product. |
| Name | Isopropylnaphthalene |
|---|---|
| Synonyms | 1-Isopropylnaphthalene; Nsc 141329 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 29253-36-9 |
| EINECS | 228-177-1 |
| SMILES | C1=C2C(=CC=C1)C(=CC=C2)C(C)C |
| InChI | 1S/C13H14/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12/h3-10H,1-2H3 |
| InChIKey | PMPBFICDXLLSRM-UHFFFAOYSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Melting point | -16°C (Expl.) |
| Boiling point | 267.999°C at 760 mmHg (Cal.) |
| Flash point | 109.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropylnaphthalene |