|
CAS#: 2928-03-2 Product: 2-Amino-3-[3-(Trifluoromethyl)Phenyl]Sulfanyl-Propanoic Acid No suppilers available for the product. |
| Name | 2-Amino-3-[3-(Trifluoromethyl)Phenyl]Sulfanyl-Propanoic Acid |
|---|---|
| Synonyms | 2-Amino-3-[3-(Trifluoromethyl)Phenyl]Sulfanyl-Propanoic Acid; 2-Amino-3-[[3-(Trifluoromethyl)Phenyl]Thio]Propanoic Acid; 2-Amino-3-[[3-(Trifluoromethyl)Phenyl]Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.25 |
| CAS Registry Number | 2928-03-2 |
| SMILES | C1=C(SCC(C(=O)O)N)C=C(C=C1)C(F)(F)F |
| InChI | 1S/C10H10F3NO2S/c11-10(12,13)6-2-1-3-7(4-6)17-5-8(14)9(15)16/h1-4,8H,5,14H2,(H,15,16) |
| InChIKey | ITDDPZZRKLGDSY-UHFFFAOYSA-N |
| Density | 1.439g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.398°C at 760 mmHg (Cal.) |
| Flash point | 168.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3-[3-(Trifluoromethyl)Phenyl]Sulfanyl-Propanoic Acid |