|
CAS#: 2929-80-8 Product: 4-[(E)-(Butylimino)Methyl]-N,N-Dimethylaniline No suppilers available for the product. |
| Name | 4-[(E)-(Butylimino)Methyl]-N,N-Dimethylaniline |
|---|---|
| Synonyms | N-[(E)-Bu |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.31 |
| CAS Registry Number | 2929-80-8 |
| SMILES | N(=C/c1ccc(N(C)C)cc1)\CCCC |
| InChI | 1S/C13H20N2/c1-4-5-10-14-11-12-6-8-13(9-7-12)15(2)3/h6-9,11H,4-5,10H2,1-3H3/b14-11+ |
| InChIKey | XVJQBYBAHXAZMQ-SDNWHVSQSA-N |
| Density | 0.903g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.866°C at 760 mmHg (Cal.) |
| Flash point | 143.621°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-[(E)-(Butylimino)Methyl]-N,N-Dimethylaniline |