|
CAS#: 29344-72-7 Product: N-[4-(Diphenylamino)Phenyl]-N-Phenylacetamide No suppilers available for the product. |
| Name | N-[4-(Diphenylamino)Phenyl]-N-Phenylacetamide |
|---|---|
| Synonyms | N-[4-(Diphenylamino)phenyl]-N-phenylacetamide # |
| Molecular Structure | ![]() |
| Molecular Formula | C26H22N2O |
| Molecular Weight | 378.47 |
| CAS Registry Number | 29344-72-7 |
| SMILES | O=C(N(c3ccc(N(c1ccccc1)c2ccccc2)cc3)c4ccccc4)C |
| InChI | 1S/C26H22N2O/c1-21(29)27(22-11-5-2-6-12-22)25-17-19-26(20-18-25)28(23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-20H,1H3 |
| InChIKey | ZCTJWJYIYQAXNM-UHFFFAOYSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.538°C at 760 mmHg (Cal.) |
| Flash point | 274.531°C (Cal.) |
| Refractive index | 1.668 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(Diphenylamino)Phenyl]-N-Phenylacetamide |