Online Database of Chemicals from Around the World
|
CAS#: 29372-67-6 Product: 1,5-Bis(4-Methoxyphenyl)-2,4-Pentadiyn-1-One No suppilers available for the product. |
| Name | 1,5-Bis(4-Methoxyphenyl)-2,4-Pentadiyn-1-One |
|---|---|
| Synonyms | 1,5-Bis(4-methoxyphenyl)-2,4-pentadiyn-1-one #; 2,4-Pentadiynophenone, 4'-methoxy-5-(p-methoxyphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.31 |
| CAS Registry Number | 29372-67-6 |
| SMILES | O=C(C#CC#Cc1ccc(OC)cc1)c2ccc(OC)cc2 |
| InChI | 1S/C19H14O3/c1-21-17-11-7-15(8-12-17)5-3-4-6-19(20)16-9-13-18(22-2)14-10-16/h7-14H,1-2H3 |
| InChIKey | IMZZZIFEYPHHMO-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.773°C at 760 mmHg (Cal.) |
| Flash point | 202.293°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Bis(4-Methoxyphenyl)-2,4-Pentadiyn-1-One |