Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054//+86 13424336463 | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 4-{(E)-[(Dimethylamino)Methylene]Amino}Benzoate |
|---|---|
| Synonyms | (E)-methyl 4-(((dimethylamino)methylene)amino)benzoate; Methyl 4-([(E)-(dimethylamino)methylidene]amino)benzoate # |
| Molecular Structure | ![CAS#: 29390-16-7, Methyl 4-{(E)-[(Dimethylamino)Methylene]Amino}Benzoate](/moreStructures/29390-16-7.gif) |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 29390-16-7 |
| SMILES | O=C(OC)c1ccc(/N=C/N(C)C)cc1 |
| InChI | 1S/C11H14N2O2/c1-13(2)8-12-10-6-4-9(5-7-10)11(14)15-3/h4-8H,1-3H3/b12-8+ |
| InChIKey | NQVUPXYJLAGUBE-XYOKQWHBSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.266°C at 760 mmHg (Cal.) |
| Flash point | 143.259°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-{(E)-[(Dimethylamino)Methylene]Amino}Benzoate |