|
CAS#: 2943-69-3 Product: 1,3-Bis(Iodomethyl)Tetramethyldisiloxane No suppilers available for the product. |
| Name | 1,3-Bis(Iodomethyl)Tetramethyldisiloxane |
|---|---|
| Synonyms | Iodomethyl-(Iodomethyl-Dimethyl-Silyl)Oxy-Dimethyl-Silane; Nsc83870 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16I2OSi2 |
| Molecular Weight | 414.17 |
| CAS Registry Number | 2943-69-3 |
| SMILES | C([Si](O[Si](CI)(C)C)(C)C)I |
| InChI | 1S/C6H16I2OSi2/c1-10(2,5-7)9-11(3,4)6-8/h5-6H2,1-4H3 |
| InChIKey | AYFZKJFGMZOAKS-UHFFFAOYSA-N |
| Density | 1.704g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.582°C at 760 mmHg (Cal.) |
| Flash point | 90.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(Iodomethyl)Tetramethyldisiloxane |