|
CAS#: 29460-67-1 Product: (2E)-3-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-2-Propen-1-Ol No suppilers available for the product. |
| Name | (2E)-3-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-2-Propen-1-Ol |
|---|---|
| Synonyms | (2E)-3-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-propen-1-ol #; α-Citrylidene ethanol; α-Cyclocitrylidene-ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 29460-67-1 |
| SMILES | OC/C=C/C1C(=C/CCC1(C)C)\C |
| InChI | 1S/C12H20O/c1-10-6-4-8-12(2,3)11(10)7-5-9-13/h5-7,11,13H,4,8-9H2,1-3H3/b7-5+ |
| InChIKey | XFXXEQAYHOHEQN-FNORWQNLSA-N |
| Density | 0.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.851°C at 760 mmHg (Cal.) |
| Flash point | 94.252°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-2-Propen-1-Ol |