Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 3-{2-[(4-Chlorophenyl)Amino]Ethyl}Phenol |
|---|---|
| Synonyms | 3-[2-(4-Chlorophenylamino)ethyl]phenol |
| Molecular Structure | ![CAS#: 295319-83-4, 3-{2-[(4-Chlorophenyl)Amino]Ethyl}Phenol](/moreStructures/295319-83-4.gif) |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 |
| CAS Registry Number | 295319-83-4 |
| SMILES | Clc2ccc(NCCc1cccc(O)c1)cc2 |
| InChI | 1S/C14H14ClNO/c15-12-4-6-13(7-5-12)16-9-8-11-2-1-3-14(17)10-11/h1-7,10,16-17H,8-9H2 |
| InChIKey | CFYVQEHNTOXUFJ-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.756°C at 760 mmHg (Cal.) |
| Flash point | 223.386°C (Cal.) |
| Refractive index | 1.651 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-{2-[(4-Chlorophenyl)Amino]Ethyl}Phenol |